C20H25N3O3 — CID 56870007
[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(3,5-dimethylpyrazol-1-yl)phenyl]methanone (PubChem CID 56870007) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(3,5-dimethylpyrazol-1-yl)phenyl]methanone.
| Compound Name | [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(3,5-dimethylpyrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 56870007 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(3,5-dimethylpyrazol-1-yl)phenyl]methanone |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)N3C[C@H]4C[C@H](O)[C@H](O)C[C@H]4C3)cc2)n1 |
| InChI | InChI=1S/C20H25N3O3/c1-12-7-13(2)23(21-12)17-5-3-14(4-6-17)20(26)22-10-15-8-18(24)19(25)9-16(15)11-22/h3-7,15-16,18-19,24-25H,8-11H2,1-2H3/t15-,16+,18+,19- |
| InChIKey | CKGYESXOEWWULQ-XHVUQVIVSA-N |
| XLogP | 1.69 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |