About 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole
1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole (PubChem CID 56870333) has the molecular formula C18H20F2N4O
and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole |
| PubChem CID | 56870333 |
| Molecular Formula | C18H20F2N4O |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole |
| SMILES | COc1ccc(F)c(F)c1-c1nccn1C(C)Cn1nc(C)cc1C |
| InChI | InChI=1S/C18H20F2N4O/c1-11-9-12(2)24(22-11)10-13(3)23-8-7-21-18(23)16-15(25-4)6-5-14(19)17(16)20/h5-9,13H,10H2,1-4H3 |
| InChIKey | VCZRMOMVIXMNSN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole?
The IUPAC name of 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole (CID 56870333) is 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole.
What is the SMILES notation for 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole?
The canonical SMILES for 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole is COc1ccc(F)c(F)c1-c1nccn1C(C)Cn1nc(C)cc1C.
What is the InChIKey of 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole?
The InChIKey is VCZRMOMVIXMNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20F2N4O/c1-11-9-12(2)24(22-11)10-13(3)23-8-7-21-18(23)16-15(25-4)6-5-14(19)17(16)20/h5-9,13H,10H2,1-4H3.
What are the key properties of 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole?
1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole has a molecular weight of 346.38 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(2,3-difluoro-6-methoxyphenyl)imidazol-1-yl]propyl]-3,5-dimethylpyrazole is sourced from PubChem (CID 56870333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).