C17H19F3N2O2 — CID 56870545
1-[2-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 56870545) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 1-[2-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 56870545 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[2-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC1=CC[C@@H]2CN(C(=O)Cn3cc(C(F)(F)F)ccc3=O)C[C@@H]2C1 |
| InChI | InChI=1S/C17H19F3N2O2/c1-11-2-3-12-7-21(8-13(12)6-11)16(24)10-22-9-14(17(18,19)20)4-5-15(22)23/h2,4-5,9,12-13H,3,6-8,10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | ARONZPGDFMDSQU-OLZOCXBDSA-N |
| XLogP | 2.68 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|