C18H23N5O2 — CID 56870811
[(4S,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-amino-1H-1,2,4-triazol-5-yl)methanone (PubChem CID 56870811) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(4S,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-amino-1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | [(4S,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-amino-1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 56870811 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | [(4S,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-amino-1H-1,2,4-triazol-5-yl)methanone |
| SMILES | Nc1n[nH]c(C(=O)N2CC[C@@](O)(c3ccccc3)[C@H]3CCCC[C@H]32)n1 |
| InChI | InChI=1S/C18H23N5O2/c19-17-20-15(21-22-17)16(24)23-11-10-18(25,12-6-2-1-3-7-12)13-8-4-5-9-14(13)23/h1-3,6-7,13-14,25H,4-5,8-11H2,(H3,19,20,21,22)/t13-,14+,18+/m0/s1 |
| InChIKey | JSTYTMFVJCIWFV-PMUMKWKESA-N |
| XLogP | 1.68 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |