C18H18ClFN2O2 — CID 56871751
4-[(4-chlorophenyl)methyl]-1-(3-fluoro-2-pyridinyl)piperidine-4-carboxylic acid (PubChem CID 56871751) has the molecular formula C18H18ClFN2O2 and a molecular weight of 348.81 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-1-(3-fluoro-2-pyridinyl)piperidine-4-carboxylic acid.
| Compound Name | 4-[(4-chlorophenyl)methyl]-1-(3-fluoro-2-pyridinyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56871751 |
| Molecular Formula | C18H18ClFN2O2 |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-1-(3-fluoro-2-pyridinyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(Cl)cc2)CCN(c2ncccc2F)CC1 |
| InChI | InChI=1S/C18H18ClFN2O2/c19-14-5-3-13(4-6-14)12-18(17(23)24)7-10-22(11-8-18)16-15(20)2-1-9-21-16/h1-6,9H,7-8,10-12H2,(H,23,24) |
| InChIKey | ZMTSKJUVUBRNMS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |