C20H23N3O3 — CID 56871990
[(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-4-phenylpyrimidin-5-yl)methanone (PubChem CID 56871990) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-4-phenylpyrimidin-5-yl)methanone.
| Compound Name | [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-4-phenylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 56871990 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-4-phenylpyrimidin-5-yl)methanone |
| SMILES | Cc1ncc(C(=O)N2C[C@H]3C[C@H](O)[C@@H](O)C[C@H]3C2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H23N3O3/c1-12-21-9-16(19(22-12)13-5-3-2-4-6-13)20(26)23-10-14-7-17(24)18(25)8-15(14)11-23/h2-6,9,14-15,17-18,24-25H,7-8,10-11H2,1H3/t14-,15+,17-,18-/m0/s1 |
| InChIKey | UURHZGNKBNYDEV-MVJTYMMSSA-N |
| XLogP | 1.66 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |