C15H25N3O — CID 56872505
1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-2-piperazin-1-ylethanone (PubChem CID 56872505) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-2-piperazin-1-ylethanone.
| Compound Name | 1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-2-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 56872505 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-2-piperazin-1-ylethanone |
| SMILES | C=CC[C@@H]1CC=C[C@@H](C)N1C(=O)CN1CCNCC1 |
| InChI | InChI=1S/C15H25N3O/c1-3-5-14-7-4-6-13(2)18(14)15(19)12-17-10-8-16-9-11-17/h3-4,6,13-14,16H,1,5,7-12H2,2H3/t13-,14-/m1/s1 |
| InChIKey | ZUWZGYDFVSYSNE-ZIAGYGMSSA-N |
| XLogP | 1.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|