C17H17NO5 — CID 56872619
methyl 2-[(2,6-dihydroxybenzoyl)amino]-2-(3-methylphenyl)acetate (PubChem CID 56872619) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl 2-[(2,6-dihydroxybenzoyl)amino]-2-(3-methylphenyl)acetate.
| Compound Name | methyl 2-[(2,6-dihydroxybenzoyl)amino]-2-(3-methylphenyl)acetate |
|---|---|
| PubChem CID | 56872619 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl 2-[(2,6-dihydroxybenzoyl)amino]-2-(3-methylphenyl)acetate |
| SMILES | COC(=O)C(NC(=O)c1c(O)cccc1O)c1cccc(C)c1 |
| InChI | InChI=1S/C17H17NO5/c1-10-5-3-6-11(9-10)15(17(22)23-2)18-16(21)14-12(19)7-4-8-13(14)20/h3-9,15,19-20H,1-2H3,(H,18,21) |
| InChIKey | KWJWJSQZJAVBMF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |