C15H21N5OS — CID 56873295
2-amino-4-ethyl-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1,3-thiazole-5-carboxamide (PubChem CID 56873295) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-amino-4-ethyl-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-ethyl-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 56873295 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-amino-4-ethyl-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(N)sc1C(=O)NCc1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C15H21N5OS/c1-2-10-13(22-15(16)18-10)14(21)17-8-12-9-6-4-3-5-7-11(9)19-20-12/h2-8H2,1H3,(H2,16,18)(H,17,21)(H,19,20) |
| InChIKey | VCPGTUNXZSIVEB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |