C23H24FN3O — CID 56873367
[3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-[3-(1H-pyrazol-4-yl)phenyl]methanone (PubChem CID 56873367) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-[3-(1H-pyrazol-4-yl)phenyl]methanone.
| Compound Name | [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-[3-(1H-pyrazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 56873367 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-[3-(1H-pyrazol-4-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-c2cn[nH]c2)c1)N1CCCC(CCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H24FN3O/c24-22-10-8-17(9-11-22)6-7-18-3-2-12-27(16-18)23(28)20-5-1-4-19(13-20)21-14-25-26-15-21/h1,4-5,8-11,13-15,18H,2-3,6-7,12,16H2,(H,25,26) |
| InChIKey | NYGXMGCOZRRDGT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |