C12H18F3N3O2 — CID 56873577
4-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]-2-(trifluoromethyl)morpholine (PubChem CID 56873577) has the molecular formula C12H18F3N3O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is 4-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]-2-(trifluoromethyl)morpholine.
| Compound Name | 4-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]-2-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 56873577 |
| Molecular Formula | C12H18F3N3O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]-2-(trifluoromethyl)morpholine |
| SMILES | COCCn1cncc1CN1CCOC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H18F3N3O2/c1-19-4-3-18-9-16-6-10(18)7-17-2-5-20-11(8-17)12(13,14)15/h6,9,11H,2-5,7-8H2,1H3 |
| InChIKey | ZXNHAKLWBNYJCT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |