C17H19F3N4 — CID 56873918
2-(3-phenylpiperazin-1-yl)-4-(3,3,3-trifluoropropyl)pyrimidine (PubChem CID 56873918) has the molecular formula C17H19F3N4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-(3-phenylpiperazin-1-yl)-4-(3,3,3-trifluoropropyl)pyrimidine.
| Compound Name | 2-(3-phenylpiperazin-1-yl)-4-(3,3,3-trifluoropropyl)pyrimidine |
|---|---|
| PubChem CID | 56873918 |
| Molecular Formula | C17H19F3N4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(3-phenylpiperazin-1-yl)-4-(3,3,3-trifluoropropyl)pyrimidine |
| SMILES | FC(F)(F)CCc1ccnc(N2CCNC(c3ccccc3)C2)n1 |
| InChI | InChI=1S/C17H19F3N4/c18-17(19,20)8-6-14-7-9-22-16(23-14)24-11-10-21-15(12-24)13-4-2-1-3-5-13/h1-5,7,9,15,21H,6,8,10-12H2 |
| InChIKey | YUCSNNUMCVLXLT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |