C22H28N4O2 — CID 56874539
1-(4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)-5-phenylpentan-1-one (PubChem CID 56874539) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-(4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)-5-phenylpentan-1-one.
| Compound Name | 1-(4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 56874539 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-(4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)-5-phenylpentan-1-one |
| SMILES | O=C(CCCCc1ccccc1)N1CCc2c(ncnc2N2CCOCC2)C1 |
| InChI | InChI=1S/C22H28N4O2/c27-21(9-5-4-8-18-6-2-1-3-7-18)26-11-10-19-20(16-26)23-17-24-22(19)25-12-14-28-15-13-25/h1-3,6-7,17H,4-5,8-16H2 |
| InChIKey | BGVFAXLKYDHIHK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|