C23H23N5O — CID 56874642
4-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]benzamide (PubChem CID 56874642) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]benzamide.
| Compound Name | 4-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 56874642 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2nc3c(c(N[C@@H]4C[C@H]4c4ccccc4)n2)CCNC3)cc1 |
| InChI | InChI=1S/C23H23N5O/c24-21(29)15-6-8-16(9-7-15)22-27-20-13-25-11-10-17(20)23(28-22)26-19-12-18(19)14-4-2-1-3-5-14/h1-9,18-19,25H,10-13H2,(H2,24,29)(H,26,27,28)/t18-,19+/m0/s1 |
| InChIKey | BSOKIMSTTYOIRT-RBUKOAKNSA-N |
| XLogP | 2.86 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |