C23H35N3O — CID 56874677
N-(cyclopropylmethyl)-1-[1-[(2-methylphenyl)methyl]piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 56874677) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-[1-[(2-methylphenyl)methyl]piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-1-[1-[(2-methylphenyl)methyl]piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56874677 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | N-(cyclopropylmethyl)-1-[1-[(2-methylphenyl)methyl]piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | Cc1ccccc1CN1CCC(N2CCC(C(=O)NCC3CC3)CC2)CC1 |
| InChI | InChI=1S/C23H35N3O/c1-18-4-2-3-5-21(18)17-25-12-10-22(11-13-25)26-14-8-20(9-15-26)23(27)24-16-19-6-7-19/h2-5,19-20,22H,6-17H2,1H3,(H,24,27) |
| InChIKey | RBMQSSNVKFWFOO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |