C17H27N3O — CID 56874747
(4aS,8aS)-2-[(2-propan-2-ylpyrimidin-4-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 56874747) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is (4aS,8aS)-2-[(2-propan-2-ylpyrimidin-4-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | (4aS,8aS)-2-[(2-propan-2-ylpyrimidin-4-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 56874747 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (4aS,8aS)-2-[(2-propan-2-ylpyrimidin-4-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CC(C)c1nccc(CN2CC[C@@]3(O)CCCC[C@H]3C2)n1 |
| InChI | InChI=1S/C17H27N3O/c1-13(2)16-18-9-6-15(19-16)12-20-10-8-17(21)7-4-3-5-14(17)11-20/h6,9,13-14,21H,3-5,7-8,10-12H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | XWQSJJHPYDKQCW-YOEHRIQHSA-N |
| XLogP | 2.73 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |