About 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid
1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 56875241) has the molecular formula C11H16ClN3O5S
and a molecular weight of 337.79 g/mol. Its IUPAC name is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid |
| PubChem CID | 56875241 |
| Molecular Formula | C11H16ClN3O5S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C11H16ClN3O5S/c1-7-8(9(12)14(2)13-7)21(19,20)15-5-3-11(18,4-6-15)10(16)17/h18H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | MNFWSFCPKHCWBY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid?
The IUPAC name of 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid (CID 56875241) is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid.
What is the SMILES notation for 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid?
The canonical SMILES for 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid is Cc1nn(C)c(Cl)c1S(=O)(=O)N1CCC(O)(C(=O)O)CC1.
What is the InChIKey of 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid?
The InChIKey is MNFWSFCPKHCWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClN3O5S/c1-7-8(9(12)14(2)13-7)21(19,20)15-5-3-11(18,4-6-15)10(16)17/h18H,3-6H2,1-2H3,(H,16,17).
What are the key properties of 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid?
1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid has a molecular weight of 337.79 g/mol, XLogP of -0.02, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4-hydroxypiperidine-4-carboxylic acid is sourced from PubChem (CID 56875241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).