About (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide
(2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide (PubChem CID 56875303) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide.
Molecular Properties
| Compound Name | (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide |
| PubChem CID | 56875303 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide |
| SMILES | Cc1noc(C)c1CNC(=O)[C@H](N)CC(C)C |
| InChI | InChI=1S/C12H21N3O2/c1-7(2)5-11(13)12(16)14-6-10-8(3)15-17-9(10)4/h7,11H,5-6,13H2,1-4H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | ASRAVJIYMKMIOQ-LLVKDONJSA-N |
| XLogP | 1.28 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide?
The IUPAC name of (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide (CID 56875303) is (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide.
What is the SMILES notation for (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide?
The canonical SMILES for (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide is Cc1noc(C)c1CNC(=O)[C@H](N)CC(C)C.
What is the InChIKey of (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide?
The InChIKey is ASRAVJIYMKMIOQ-LLVKDONJSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-7(2)5-11(13)12(16)14-6-10-8(3)15-17-9(10)4/h7,11H,5-6,13H2,1-4H3,(H,14,16)/t11-/m1/s1.
What are the key properties of (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide?
(2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide has a molecular weight of 239.32 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylpentanamide is sourced from PubChem (CID 56875303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).