About N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide (PubChem CID 56875537) has the molecular formula C23H25N3O2
and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide.
Molecular Properties
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide |
| PubChem CID | 56875537 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide |
| SMILES | CCC(C(=O)NCc1ccc2[nH]c(C)c(C)c2c1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C23H25N3O2/c1-4-21(26-13-17-7-5-6-8-18(17)23(26)28)22(27)24-12-16-9-10-20-19(11-16)14(2)15(3)25-20/h5-11,21,25H,4,12-13H2,1-3H3,(H,24,27) |
| InChIKey | RRXZULVSHFKVGO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide?
The IUPAC name of N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide (CID 56875537) is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide.
What is the SMILES notation for N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide?
The canonical SMILES for N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide is CCC(C(=O)NCc1ccc2[nH]c(C)c(C)c2c1)N1Cc2ccccc2C1=O.
What is the InChIKey of N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide?
The InChIKey is RRXZULVSHFKVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O2/c1-4-21(26-13-17-7-5-6-8-18(17)23(26)28)22(27)24-12-16-9-10-20-19(11-16)14(2)15(3)25-20/h5-11,21,25H,4,12-13H2,1-3H3,(H,24,27).
What are the key properties of N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide?
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide has a molecular weight of 375.47 g/mol, XLogP of 3.84, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(3-oxo-1H-isoindol-2-yl)butanamide is sourced from PubChem (CID 56875537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).