About 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol
1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol (PubChem CID 56876137) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol.
Molecular Properties
| Compound Name | 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol |
| PubChem CID | 56876137 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol |
| SMILES | CCC(O)CNc1nccc(-c2ccc(C)nc2C)n1 |
| InChI | InChI=1S/C15H20N4O/c1-4-12(20)9-17-15-16-8-7-14(19-15)13-6-5-10(2)18-11(13)3/h5-8,12,20H,4,9H2,1-3H3,(H,16,17,19) |
| InChIKey | LCTHPLIPHSCAPZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol?
The IUPAC name of 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol (CID 56876137) is 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol.
What is the SMILES notation for 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol?
The canonical SMILES for 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol is CCC(O)CNc1nccc(-c2ccc(C)nc2C)n1.
What is the InChIKey of 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol?
The InChIKey is LCTHPLIPHSCAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O/c1-4-12(20)9-17-15-16-8-7-14(19-15)13-6-5-10(2)18-11(13)3/h5-8,12,20H,4,9H2,1-3H3,(H,16,17,19).
What are the key properties of 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol?
1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol has a molecular weight of 272.35 g/mol, XLogP of 2.34, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butan-2-ol is sourced from PubChem (CID 56876137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).