C18H24N2O — CID 56877209
[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-propyl-4-pyridinyl)methanone (PubChem CID 56877209) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-propyl-4-pyridinyl)methanone.
| Compound Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-propyl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 56877209 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-propyl-4-pyridinyl)methanone |
| SMILES | CCCc1cc(C(=O)N2C[C@H]3CC=C(C)C[C@H]3C2)ccn1 |
| InChI | InChI=1S/C18H24N2O/c1-3-4-17-10-14(7-8-19-17)18(21)20-11-15-6-5-13(2)9-16(15)12-20/h5,7-8,10,15-16H,3-4,6,9,11-12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | LMIWCUGOIIBCNA-CVEARBPZSA-N |
| XLogP | 3.46 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|