About [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone
[(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone (PubChem CID 56877456) has the molecular formula C16H20N4O2
and a molecular weight of 300.36 g/mol. Its IUPAC name is [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone.
Molecular Properties
| Compound Name | [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone |
| PubChem CID | 56877456 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone |
| SMILES | CO[C@H]1CN(C(=O)c2ccc(-c3ccn[nH]3)cc2)CC[C@H]1N |
| InChI | InChI=1S/C16H20N4O2/c1-22-15-10-20(9-7-13(15)17)16(21)12-4-2-11(3-5-12)14-6-8-18-19-14/h2-6,8,13,15H,7,9-10,17H2,1H3,(H,18,19)/t13-,15+/m1/s1 |
| InChIKey | UXRLGSMVRIBVPM-HIFRSBDPSA-N |
| XLogP | 1.26 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone?
The IUPAC name of [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone (CID 56877456) is [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone.
What is the SMILES notation for [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone?
The canonical SMILES for [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone is CO[C@H]1CN(C(=O)c2ccc(-c3ccn[nH]3)cc2)CC[C@H]1N.
What is the InChIKey of [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone?
The InChIKey is UXRLGSMVRIBVPM-HIFRSBDPSA-N. The full InChI is InChI=1S/C16H20N4O2/c1-22-15-10-20(9-7-13(15)17)16(21)12-4-2-11(3-5-12)14-6-8-18-19-14/h2-6,8,13,15H,7,9-10,17H2,1H3,(H,18,19)/t13-,15+/m1/s1.
What are the key properties of [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone?
[(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone has a molecular weight of 300.36 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone is sourced from PubChem (CID 56877456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).