C21H23N5O2 — CID 56877479
4-benzyl-3-[1-(2-pyridin-3-ylacetyl)piperidin-4-yl]-1H-1,2,4-triazol-5-one (PubChem CID 56877479) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-benzyl-3-[1-(2-pyridin-3-ylacetyl)piperidin-4-yl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-benzyl-3-[1-(2-pyridin-3-ylacetyl)piperidin-4-yl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 56877479 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 4-benzyl-3-[1-(2-pyridin-3-ylacetyl)piperidin-4-yl]-1H-1,2,4-triazol-5-one |
| SMILES | O=C(Cc1cccnc1)N1CCC(c2n[nH]c(=O)n2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N5O2/c27-19(13-17-7-4-10-22-14-17)25-11-8-18(9-12-25)20-23-24-21(28)26(20)15-16-5-2-1-3-6-16/h1-7,10,14,18H,8-9,11-13,15H2,(H,24,28) |
| InChIKey | PPSAMJKASNHACP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |