About [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol
[6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol (PubChem CID 56877480) has the molecular formula C20H15N5O2
and a molecular weight of 357.37 g/mol. Its IUPAC name is [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol.
Molecular Properties
| Compound Name | [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol |
| PubChem CID | 56877480 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol |
| SMILES | OCc1nc2ccc(-n3ccnc3-c3cc(-c4ccccc4)no3)cc2[nH]1 |
| InChI | InChI=1S/C20H15N5O2/c26-12-19-22-15-7-6-14(10-17(15)23-19)25-9-8-21-20(25)18-11-16(24-27-18)13-4-2-1-3-5-13/h1-11,26H,12H2,(H,22,23) |
| InChIKey | TWICIOFOWWAKFI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol?
The IUPAC name of [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol (CID 56877480) is [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol.
What is the SMILES notation for [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol?
The canonical SMILES for [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol is OCc1nc2ccc(-n3ccnc3-c3cc(-c4ccccc4)no3)cc2[nH]1.
What is the InChIKey of [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol?
The InChIKey is TWICIOFOWWAKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O2/c26-12-19-22-15-7-6-14(10-17(15)23-19)25-9-8-21-20(25)18-11-16(24-27-18)13-4-2-1-3-5-13/h1-11,26H,12H2,(H,22,23).
What are the key properties of [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol?
[6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol has a molecular weight of 357.37 g/mol, XLogP of 3.56, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[2-(3-phenyl-1,2-oxazol-5-yl)imidazol-1-yl]-1H-benzimidazol-2-yl]methanol is sourced from PubChem (CID 56877480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).