C20H29N5O — CID 56878120
cyclopropyl-[4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethylamino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone (PubChem CID 56878120) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is cyclopropyl-[4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethylamino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone.
| Compound Name | cyclopropyl-[4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethylamino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 56878120 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | cyclopropyl-[4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethylamino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone |
| SMILES | O=C(C1CC1)N1CCc2c(ncnc2NCCC23CCCN2CCC3)C1 |
| InChI | InChI=1S/C20H29N5O/c26-19(15-3-4-15)24-12-5-16-17(13-24)22-14-23-18(16)21-9-8-20-6-1-10-25(20)11-2-7-20/h14-15H,1-13H2,(H,21,22,23) |
| InChIKey | XJJQDXDSNSLDQO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |