C14H12ClF3N2O — CID 56878178
2-(2-chloro-6-methoxyphenyl)-4-(3,3,3-trifluoropropyl)pyrimidine (PubChem CID 56878178) has the molecular formula C14H12ClF3N2O and a molecular weight of 316.71 g/mol. Its IUPAC name is 2-(2-chloro-6-methoxyphenyl)-4-(3,3,3-trifluoropropyl)pyrimidine.
| Compound Name | 2-(2-chloro-6-methoxyphenyl)-4-(3,3,3-trifluoropropyl)pyrimidine |
|---|---|
| PubChem CID | 56878178 |
| Molecular Formula | C14H12ClF3N2O |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(2-chloro-6-methoxyphenyl)-4-(3,3,3-trifluoropropyl)pyrimidine |
| SMILES | COc1cccc(Cl)c1-c1nccc(CCC(F)(F)F)n1 |
| InChI | InChI=1S/C14H12ClF3N2O/c1-21-11-4-2-3-10(15)12(11)13-19-8-6-9(20-13)5-7-14(16,17)18/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | MLWHGBSFWXDUBN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |