About [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine
[1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine (PubChem CID 56878274) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine |
| PubChem CID | 56878274 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine |
| SMILES | CCn1ncnc1CN1CCC(CN)C1 |
| InChI | InChI=1S/C10H19N5/c1-2-15-10(12-8-13-15)7-14-4-3-9(5-11)6-14/h8-9H,2-7,11H2,1H3 |
| InChIKey | PGDREZYSLKXDEK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine?
The IUPAC name of [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine (CID 56878274) is [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine is CCn1ncnc1CN1CCC(CN)C1.
What is the InChIKey of [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine?
The InChIKey is PGDREZYSLKXDEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5/c1-2-15-10(12-8-13-15)7-14-4-3-9(5-11)6-14/h8-9H,2-7,11H2,1H3.
What are the key properties of [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine?
[1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine has a molecular weight of 209.30 g/mol, XLogP of 0.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-yl]methanamine is sourced from PubChem (CID 56878274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).