About N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide
N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 56878370) has the molecular formula C13H15FN2O3
and a molecular weight of 266.27 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| PubChem CID | 56878370 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CC1=NOC(C(=O)NCCOc2ccccc2F)C1 |
| InChI | InChI=1S/C13H15FN2O3/c1-9-8-12(19-16-9)13(17)15-6-7-18-11-5-3-2-4-10(11)14/h2-5,12H,6-8H2,1H3,(H,15,17) |
| InChIKey | JWWYTOSSXSIQJI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide (CID 56878370) is N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide is CC1=NOC(C(=O)NCCOc2ccccc2F)C1.
What is the InChIKey of N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The InChIKey is JWWYTOSSXSIQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O3/c1-9-8-12(19-16-9)13(17)15-6-7-18-11-5-3-2-4-10(11)14/h2-5,12H,6-8H2,1H3,(H,15,17).
What are the key properties of N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide?
N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide has a molecular weight of 266.27 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-fluorophenoxy)ethyl]-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 56878370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).