C13H19N3O3 — CID 56878690
[5-[(E)-but-2-enyl]-1,3,4-oxadiazol-2-yl]-(2,2-dimethylmorpholin-4-yl)methanone (PubChem CID 56878690) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is [5-[(E)-but-2-enyl]-1,3,4-oxadiazol-2-yl]-(2,2-dimethylmorpholin-4-yl)methanone.
| Compound Name | [5-[(E)-but-2-enyl]-1,3,4-oxadiazol-2-yl]-(2,2-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 56878690 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [5-[(E)-but-2-enyl]-1,3,4-oxadiazol-2-yl]-(2,2-dimethylmorpholin-4-yl)methanone |
| SMILES | C/C=C/Cc1nnc(C(=O)N2CCOC(C)(C)C2)o1 |
| InChI | InChI=1S/C13H19N3O3/c1-4-5-6-10-14-15-11(19-10)12(17)16-7-8-18-13(2,3)9-16/h4-5H,6-9H2,1-3H3/b5-4+ |
| InChIKey | XBPJSJZTOMONFS-SNAWJCMRSA-N |
| XLogP | 1.44 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|