C10H12FN3O3 — CID 56879120
1-(5-fluoropyrimidin-2-yl)-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 56879120) has the molecular formula C10H12FN3O3 and a molecular weight of 241.22 g/mol. Its IUPAC name is 1-(5-fluoropyrimidin-2-yl)-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-(5-fluoropyrimidin-2-yl)-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56879120 |
| Molecular Formula | C10H12FN3O3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(5-fluoropyrimidin-2-yl)-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(O)CCN(c2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C10H12FN3O3/c11-7-5-12-9(13-6-7)14-3-1-10(17,2-4-14)8(15)16/h5-6,17H,1-4H2,(H,15,16) |
| InChIKey | XXKXYJUGHUSIIO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |