C18H32N4O2 — CID 56879136
1-[4-[3-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethanone (PubChem CID 56879136) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[4-[3-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 56879136 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-[4-[3-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(N2CCCC(C(=O)N3CCN(C)CC3)C2)CC1 |
| InChI | InChI=1S/C18H32N4O2/c1-15(23)20-8-5-17(6-9-20)22-7-3-4-16(14-22)18(24)21-12-10-19(2)11-13-21/h16-17H,3-14H2,1-2H3 |
| InChIKey | QWVYUQQTPGOQNH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |