C19H27N5O — CID 56879149
[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methanone (PubChem CID 56879149) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methanone.
| Compound Name | [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 56879149 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methanone |
| SMILES | Cc1nc(N2CCN(C)CC2)ncc1C(=O)N1C[C@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C19H27N5O/c1-14-17(11-20-19(21-14)23-9-7-22(2)8-10-23)18(25)24-12-15-5-3-4-6-16(15)13-24/h3-4,11,15-16H,5-10,12-13H2,1-2H3/t15-,16+ |
| InChIKey | RDNDITFQSXWILR-IYBDPMFKSA-N |
| XLogP | 1.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|