About 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one
9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one (PubChem CID 56879610) has the molecular formula C16H19F2NO2
and a molecular weight of 295.33 g/mol. Its IUPAC name is 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one.
Molecular Properties
| Compound Name | 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one |
| PubChem CID | 56879610 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one |
| SMILES | O=C1CCC2(CCCO2)CCN1Cc1c(F)cccc1F |
| InChI | InChI=1S/C16H19F2NO2/c17-13-3-1-4-14(18)12(13)11-19-9-8-16(6-2-10-21-16)7-5-15(19)20/h1,3-4H,2,5-11H2 |
| InChIKey | ZNRQHUMLHGAKIV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one?
The IUPAC name of 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one (CID 56879610) is 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one.
What is the SMILES notation for 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one?
The canonical SMILES for 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one is O=C1CCC2(CCCO2)CCN1Cc1c(F)cccc1F.
What is the InChIKey of 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one?
The InChIKey is ZNRQHUMLHGAKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2NO2/c17-13-3-1-4-14(18)12(13)11-19-9-8-16(6-2-10-21-16)7-5-15(19)20/h1,3-4H,2,5-11H2.
What are the key properties of 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one?
9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one has a molecular weight of 295.33 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,6-difluorophenyl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one is sourced from PubChem (CID 56879610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).