C22H26N4O3 — CID 56880211
2-[(2R,3S,6R)-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 56880211) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[(2R,3S,6R)-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 2-[(2R,3S,6R)-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 56880211 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[(2R,3S,6R)-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | O=C1NC(=O)C2(CC(C(=O)N3C[C@H](c4ccccc4)[C@@H]4[C@H]3C3CCN4CC3)C2)N1 |
| InChI | InChI=1S/C22H26N4O3/c27-19(15-10-22(11-15)20(28)23-21(29)24-22)26-12-16(13-4-2-1-3-5-13)18-17(26)14-6-8-25(18)9-7-14/h1-5,14-18H,6-12H2,(H2,23,24,28,29)/t15?,16-,17-,18-,22?/m1/s1 |
| InChIKey | PULPOOLACGYMNN-LJPAYWBRSA-N |
| XLogP | 1.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|