C13H15F6N3O — CID 56880225
4-[6-propan-2-yl-2-(trifluoromethyl)pyrimidin-4-yl]-2-(trifluoromethyl)morpholine (PubChem CID 56880225) has the molecular formula C13H15F6N3O and a molecular weight of 343.27 g/mol. Its IUPAC name is 4-[6-propan-2-yl-2-(trifluoromethyl)pyrimidin-4-yl]-2-(trifluoromethyl)morpholine.
| Compound Name | 4-[6-propan-2-yl-2-(trifluoromethyl)pyrimidin-4-yl]-2-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 56880225 |
| Molecular Formula | C13H15F6N3O |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-[6-propan-2-yl-2-(trifluoromethyl)pyrimidin-4-yl]-2-(trifluoromethyl)morpholine |
| SMILES | CC(C)c1cc(N2CCOC(C(F)(F)F)C2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H15F6N3O/c1-7(2)8-5-10(21-11(20-8)13(17,18)19)22-3-4-23-9(6-22)12(14,15)16/h5,7,9H,3-4,6H2,1-2H3 |
| InChIKey | BFDXMDGPYDPQOS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |