About morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone
morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 56880472) has the molecular formula C16H22F3N5O2
and a molecular weight of 373.38 g/mol. Its IUPAC name is morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
| PubChem CID | 56880472 |
| Molecular Formula | C16H22F3N5O2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | O=C(N1CCOCC1)N1CCN(c2nccc(CCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C16H22F3N5O2/c17-16(18,19)3-1-13-2-4-20-14(21-13)22-5-7-23(8-6-22)15(25)24-9-11-26-12-10-24/h2,4H,1,3,5-12H2 |
| InChIKey | FIVXQOQYOWZAGL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone?
The IUPAC name of morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone (CID 56880472) is morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone.
What is the SMILES notation for morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone?
The canonical SMILES for morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone is O=C(N1CCOCC1)N1CCN(c2nccc(CCC(F)(F)F)n2)CC1.
What is the InChIKey of morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone?
The InChIKey is FIVXQOQYOWZAGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F3N5O2/c17-16(18,19)3-1-13-2-4-20-14(21-13)22-5-7-23(8-6-22)15(25)24-9-11-26-12-10-24/h2,4H,1,3,5-12H2.
What are the key properties of morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone?
morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone has a molecular weight of 373.38 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-[4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-1-yl]methanone is sourced from PubChem (CID 56880472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).