C15H13ClN4O2S — CID 56880676
6-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 56880676) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is 6-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 56880676 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 6-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1cc2c(cc1Cc1nn3c(C4CC4)nnc3s1)OCCO2 |
| InChI | InChI=1S/C15H13ClN4O2S/c16-10-7-12-11(21-3-4-22-12)5-9(10)6-13-19-20-14(8-1-2-8)17-18-15(20)23-13/h5,7-8H,1-4,6H2 |
| InChIKey | BYRHCFOUQDUDCT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |