C21H23NO6S — CID 56880851
3-(azepan-1-ylsulfonyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)benzoic acid (PubChem CID 56880851) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)benzoic acid.
| Compound Name | 3-(azepan-1-ylsulfonyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)benzoic acid |
|---|---|
| PubChem CID | 56880851 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc3c(c2)OCCO3)cc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H23NO6S/c23-21(24)17-11-16(15-5-6-19-20(14-15)28-10-9-27-19)12-18(13-17)29(25,26)22-7-3-1-2-4-8-22/h5-6,11-14H,1-4,7-10H2,(H,23,24) |
| InChIKey | MZMSXACTJYGVEG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |