About 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole
4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole (PubChem CID 56880936) has the molecular formula C17H19N5OS
and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole.
Molecular Properties
| Compound Name | 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole |
| PubChem CID | 56880936 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole |
| SMILES | COc1cc2c(cc1-c1nccn1CCSc1cn[nH]n1)CCC2 |
| InChI | InChI=1S/C17H19N5OS/c1-23-15-10-13-4-2-3-12(13)9-14(15)17-18-5-6-22(17)7-8-24-16-11-19-21-20-16/h5-6,9-11H,2-4,7-8H2,1H3,(H,19,20,21) |
| InChIKey | HQPQCSKJKQMQQS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole?
The IUPAC name of 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole (CID 56880936) is 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole.
What is the SMILES notation for 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole?
The canonical SMILES for 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole is COc1cc2c(cc1-c1nccn1CCSc1cn[nH]n1)CCC2.
What is the InChIKey of 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole?
The InChIKey is HQPQCSKJKQMQQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5OS/c1-23-15-10-13-4-2-3-12(13)9-14(15)17-18-5-6-22(17)7-8-24-16-11-19-21-20-16/h5-6,9-11H,2-4,7-8H2,1H3,(H,19,20,21).
What are the key properties of 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole?
4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole has a molecular weight of 341.44 g/mol, XLogP of 2.96, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)imidazol-1-yl]ethylsulfanyl]-2H-triazole is sourced from PubChem (CID 56880936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).