C17H21N5 — CID 56881625
4-N-(2,3-dihydro-1H-inden-2-yl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56881625) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1H-inden-2-yl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-(2,3-dihydro-1H-inden-2-yl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56881625 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-N-(2,3-dihydro-1H-inden-2-yl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc2c(c(NC3Cc4ccccc4C3)n1)CCNCC2 |
| InChI | InChI=1S/C17H21N5/c18-17-21-15-6-8-19-7-5-14(15)16(22-17)20-13-9-11-3-1-2-4-12(11)10-13/h1-4,13,19H,5-10H2,(H3,18,20,21,22) |
| InChIKey | HYUPEEXLQIGTLQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |