C15H22N4O3 — CID 56881772
N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]-2-oxopentanamide (PubChem CID 56881772) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]-2-oxopentanamide.
| Compound Name | N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]-2-oxopentanamide |
|---|---|
| PubChem CID | 56881772 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]-2-oxopentanamide |
| SMILES | CCCC(=O)C(=O)NCC1CCN(c2cnn(C)c(=O)c2)C1 |
| InChI | InChI=1S/C15H22N4O3/c1-3-4-13(20)15(22)16-8-11-5-6-19(10-11)12-7-14(21)18(2)17-9-12/h7,9,11H,3-6,8,10H2,1-2H3,(H,16,22) |
| InChIKey | WMLLCYXBBWKLRF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|