About 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane
7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane (PubChem CID 56882262) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane |
| PubChem CID | 56882262 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane |
| SMILES | COCCN1CCCC2(CCNC2)C1 |
| InChI | InChI=1S/C11H22N2O/c1-14-8-7-13-6-2-3-11(10-13)4-5-12-9-11/h12H,2-10H2,1H3 |
| InChIKey | BAFMMLHYUHAVQP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane?
The IUPAC name of 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane (CID 56882262) is 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane?
The canonical SMILES for 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane is COCCN1CCCC2(CCNC2)C1.
What is the InChIKey of 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane?
The InChIKey is BAFMMLHYUHAVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-14-8-7-13-6-2-3-11(10-13)4-5-12-9-11/h12H,2-10H2,1H3.
What are the key properties of 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane?
7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane has a molecular weight of 198.31 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methoxyethyl)-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 56882262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).