C9H12F3N3O2S — CID 56882394
8-(2,2,2-trifluoroethylsulfonyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine (PubChem CID 56882394) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.27 g/mol. Its IUPAC name is 8-(2,2,2-trifluoroethylsulfonyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine.
| Compound Name | 8-(2,2,2-trifluoroethylsulfonyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 56882394 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 8-(2,2,2-trifluoroethylsulfonyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
| SMILES | O=S(=O)(CC(F)(F)F)N1CCCn2cncc2C1 |
| InChI | InChI=1S/C9H12F3N3O2S/c10-9(11,12)6-18(16,17)15-3-1-2-14-7-13-4-8(14)5-15/h4,7H,1-3,5-6H2 |
| InChIKey | QBFHKJWSGKLPFH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |