C16H26N4OS — CID 56882440
(4aS,8aR)-6-(1H-imidazol-2-ylmethyl)-1-(3-methylsulfanylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56882440) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is (4aS,8aR)-6-(1H-imidazol-2-ylmethyl)-1-(3-methylsulfanylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(1H-imidazol-2-ylmethyl)-1-(3-methylsulfanylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56882440 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (4aS,8aR)-6-(1H-imidazol-2-ylmethyl)-1-(3-methylsulfanylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CSCCCN1C(=O)CC[C@H]2CN(Cc3ncc[nH]3)CC[C@H]21 |
| InChI | InChI=1S/C16H26N4OS/c1-22-10-2-8-20-14-5-9-19(12-15-17-6-7-18-15)11-13(14)3-4-16(20)21/h6-7,13-14H,2-5,8-12H2,1H3,(H,17,18)/t13-,14+/m0/s1 |
| InChIKey | UBUSBRMLVZHSEK-UONOGXRCSA-N |
| XLogP | 1.98 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|