About 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide
4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide (PubChem CID 56882465) has the molecular formula C15H24N2O4S
and a molecular weight of 328.43 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide |
| PubChem CID | 56882465 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide |
| SMILES | COc1c(C)cc(S(=O)(=O)NCC2CNCCOC2)cc1C |
| InChI | InChI=1S/C15H24N2O4S/c1-11-6-14(7-12(2)15(11)20-3)22(18,19)17-9-13-8-16-4-5-21-10-13/h6-7,13,16-17H,4-5,8-10H2,1-3H3 |
| InChIKey | XFSUCOUHKYAXJW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide?
The IUPAC name of 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide (CID 56882465) is 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide.
What is the SMILES notation for 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide?
The canonical SMILES for 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide is COc1c(C)cc(S(=O)(=O)NCC2CNCCOC2)cc1C.
What is the InChIKey of 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide?
The InChIKey is XFSUCOUHKYAXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O4S/c1-11-6-14(7-12(2)15(11)20-3)22(18,19)17-9-13-8-16-4-5-21-10-13/h6-7,13,16-17H,4-5,8-10H2,1-3H3.
What are the key properties of 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide?
4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide has a molecular weight of 328.43 g/mol, XLogP of 0.83, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,5-dimethyl-N-(1,4-oxazepan-6-ylmethyl)benzenesulfonamide is sourced from PubChem (CID 56882465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).