C15H21N3 — CID 56882851
(3aS,7aR)-2-(5-ethyl-2-methylpyrimidin-4-yl)-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56882851) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (3aS,7aR)-2-(5-ethyl-2-methylpyrimidin-4-yl)-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aS,7aR)-2-(5-ethyl-2-methylpyrimidin-4-yl)-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56882851 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (3aS,7aR)-2-(5-ethyl-2-methylpyrimidin-4-yl)-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | CCc1cnc(C)nc1N1C[C@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C15H21N3/c1-3-12-8-16-11(2)17-15(12)18-9-13-6-4-5-7-14(13)10-18/h4-5,8,13-14H,3,6-7,9-10H2,1-2H3/t13-,14+ |
| InChIKey | SHAXURWKACUFLH-OKILXGFUSA-N |
| XLogP | 2.75 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|