C18H25N5S — CID 56882870
7-(cyclopropylmethyl)-2-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 56882870) has the molecular formula C18H25N5S and a molecular weight of 343.50 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-2-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 7-(cyclopropylmethyl)-2-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 56882870 |
| Molecular Formula | C18H25N5S |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 7-(cyclopropylmethyl)-2-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | Cc1nc2c(c(NCCc3nccs3)n1)CCN(CC1CC1)CC2 |
| InChI | InChI=1S/C18H25N5S/c1-13-21-16-6-10-23(12-14-2-3-14)9-5-15(16)18(22-13)20-7-4-17-19-8-11-24-17/h8,11,14H,2-7,9-10,12H2,1H3,(H,20,21,22) |
| InChIKey | XTPOOWVSRZXEKG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |