About 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one
2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one (PubChem CID 56882884) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one.
Molecular Properties
| Compound Name | 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one |
| PubChem CID | 56882884 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one |
| SMILES | COc1coc(CN2CC[C@H](CO)[C@H](O)C2)cc1=O |
| InChI | InChI=1S/C13H19NO5/c1-18-13-8-19-10(4-11(13)16)5-14-3-2-9(7-15)12(17)6-14/h4,8-9,12,15,17H,2-3,5-7H2,1H3/t9-,12-/m1/s1 |
| InChIKey | QUXMZRYPCAIZDS-BXKDBHETSA-N |
| XLogP | -0.18 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one?
The IUPAC name of 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one (CID 56882884) is 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one.
What is the SMILES notation for 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one?
The canonical SMILES for 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one is COc1coc(CN2CC[C@H](CO)[C@H](O)C2)cc1=O.
What is the InChIKey of 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one?
The InChIKey is QUXMZRYPCAIZDS-BXKDBHETSA-N. The full InChI is InChI=1S/C13H19NO5/c1-18-13-8-19-10(4-11(13)16)5-14-3-2-9(7-15)12(17)6-14/h4,8-9,12,15,17H,2-3,5-7H2,1H3/t9-,12-/m1/s1.
What are the key properties of 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one?
2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one has a molecular weight of 269.30 g/mol, XLogP of -0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methyl]-5-methoxypyran-4-one is sourced from PubChem (CID 56882884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).