C16H28N4O3 — CID 56883336
(4aS,8aR)-1-[2-(methylamino)ethyl]-6-(morpholine-4-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56883336) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(methylamino)ethyl]-6-(morpholine-4-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-(morpholine-4-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56883336 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-(morpholine-4-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(C(=O)N3CCOCC3)CC[C@H]21 |
| InChI | InChI=1S/C16H28N4O3/c1-17-5-7-20-14-4-6-19(12-13(14)2-3-15(20)21)16(22)18-8-10-23-11-9-18/h13-14,17H,2-12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | DCKTVKQBCRJSEP-UONOGXRCSA-N |
| XLogP | -0.03 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |