About N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine
N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine (PubChem CID 56883486) has the molecular formula C22H22N4O
and a molecular weight of 358.45 g/mol. Its IUPAC name is N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine |
| PubChem CID | 56883486 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine |
| SMILES | CN(Cc1cccc(Cn2cccn2)c1)Cc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C22H22N4O/c1-25(17-21-14-22(24-27-21)20-9-3-2-4-10-20)15-18-7-5-8-19(13-18)16-26-12-6-11-23-26/h2-14H,15-17H2,1H3 |
| InChIKey | LYQTUOZEYAMNAH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine?
The IUPAC name of N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine (CID 56883486) is N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine.
What is the SMILES notation for N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine?
The canonical SMILES for N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine is CN(Cc1cccc(Cn2cccn2)c1)Cc1cc(-c2ccccc2)no1.
What is the InChIKey of N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine?
The InChIKey is LYQTUOZEYAMNAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O/c1-25(17-21-14-22(24-27-21)20-9-3-2-4-10-20)15-18-7-5-8-19(13-18)16-26-12-6-11-23-26/h2-14H,15-17H2,1H3.
What are the key properties of N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine?
N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine has a molecular weight of 358.45 g/mol, XLogP of 4.22, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine is sourced from PubChem (CID 56883486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).